C18H19ClF3NO — CID 141197585
4-[2-chloro-4-[3-(trifluoromethyl)phenoxy]phenyl]-2-methylbutan-2-amine (PubChem CID 141197585) has the molecular formula C18H19ClF3NO and a molecular weight of 357.80 g/mol. Its IUPAC name is 4-[2-chloro-4-[3-(trifluoromethyl)phenoxy]phenyl]-2-methylbutan-2-amine.
| Compound Name | 4-[2-chloro-4-[3-(trifluoromethyl)phenoxy]phenyl]-2-methylbutan-2-amine |
|---|---|
| PubChem CID | 141197585 |
| Molecular Formula | C18H19ClF3NO |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 4-[2-chloro-4-[3-(trifluoromethyl)phenoxy]phenyl]-2-methylbutan-2-amine |
| SMILES | CC(C)(N)CCc1ccc(Oc2cccc(C(F)(F)F)c2)cc1Cl |
| InChI | InChI=1S/C18H19ClF3NO/c1-17(2,23)9-8-12-6-7-15(11-16(12)19)24-14-5-3-4-13(10-14)18(20,21)22/h3-7,10-11H,8-9,23H2,1-2H3 |
| InChIKey | PMMMGBGWZMOWIF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |