C21H29Cl2NO2 — CID 68588137
(2R)-2-amino-5-[2-chloro-4-(3-propylphenoxy)phenyl]-2-methylpentan-1-ol;hydrochloride (PubChem CID 68588137) has the molecular formula C21H29Cl2NO2 and a molecular weight of 398.37 g/mol. Its IUPAC name is (2R)-2-amino-5-[2-chloro-4-(3-propylphenoxy)phenyl]-2-methylpentan-1-ol;hydrochloride.
| Compound Name | (2R)-2-amino-5-[2-chloro-4-(3-propylphenoxy)phenyl]-2-methylpentan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 68588137 |
| Molecular Formula | C21H29Cl2NO2 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | (2R)-2-amino-5-[2-chloro-4-(3-propylphenoxy)phenyl]-2-methylpentan-1-ol;hydrochloride |
| SMILES | CCCc1cccc(Oc2ccc(CCC[C@@](C)(N)CO)c(Cl)c2)c1.Cl |
| InChI | InChI=1S/C21H28ClNO2.ClH/c1-3-6-16-7-4-9-18(13-16)25-19-11-10-17(20(22)14-19)8-5-12-21(2,23)15-24;/h4,7,9-11,13-14,24H,3,5-6,8,12,15,23H2,1-2H3;1H/t21-;/m1./s1 |
| InChIKey | WRXDXCOKCMLORL-ZMBIFBSDSA-N |
| XLogP | 5.54 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |