C42H54Cl2N2O5P+ — CID 69008899
bis[(2R)-2-amino-5-[2-chloro-4-(3-propylphenoxy)phenyl]-2-methylpentoxy]-oxophosphanium (PubChem CID 69008899) has the molecular formula C42H54Cl2N2O5P+ and a molecular weight of 768.78 g/mol. Its IUPAC name is bis[(2R)-2-amino-5-[2-chloro-4-(3-propylphenoxy)phenyl]-2-methylpentoxy]-oxophosphanium.
| Compound Name | bis[(2R)-2-amino-5-[2-chloro-4-(3-propylphenoxy)phenyl]-2-methylpentoxy]-oxophosphanium |
|---|---|
| PubChem CID | 69008899 |
| Molecular Formula | C42H54Cl2N2O5P+ |
| Molecular Weight | 768.78 g/mol |
| Exact Mass | 767.31 |
| IUPAC Name | bis[(2R)-2-amino-5-[2-chloro-4-(3-propylphenoxy)phenyl]-2-methylpentoxy]-oxophosphanium |
| SMILES | CCCc1cccc(Oc2ccc(CCC[C@@](C)(N)CO[P+](=O)OC[C@](C)(N)CCCc3ccc(Oc4cccc(CCC)c4)cc3Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C42H54Cl2N2O5P/c1-5-11-31-13-7-17-35(25-31)50-37-21-19-33(39(43)27-37)15-9-23-41(3,45)29-48-52(47)49-30-42(4,46)24-10-16-34-20-22-38(28-40(34)44)51-36-18-8-14-32(26-36)12-6-2/h7-8,13-14,17-22,25-28H,5-6,9-12,15-16,23-24,29-30,45-46H2,1-4H3/q+1/t41-,42-/m1/s1 |
| InChIKey | GZSCAZMRXWWPHP-NCRNUEESSA-N |
| XLogP | 11.95 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.78 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|