C26H37ClNO7P — CID 58022577
tert-butyl N-[(2R)-5-[2-chloro-4-(3-methylphenoxy)phenyl]-1-dimethoxyphosphoryloxy-2-methylpentan-2-yl]carbamate (PubChem CID 58022577) has the molecular formula C26H37ClNO7P and a molecular weight of 542.01 g/mol. Its IUPAC name is tert-butyl N-[(2R)-5-[2-chloro-4-(3-methylphenoxy)phenyl]-1-dimethoxyphosphoryloxy-2-methylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-5-[2-chloro-4-(3-methylphenoxy)phenyl]-1-dimethoxyphosphoryloxy-2-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 58022577 |
| Molecular Formula | C26H37ClNO7P |
| Molecular Weight | 542.01 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | tert-butyl N-[(2R)-5-[2-chloro-4-(3-methylphenoxy)phenyl]-1-dimethoxyphosphoryloxy-2-methylpentan-2-yl]carbamate |
| SMILES | COP(=O)(OC)OC[C@@](C)(CCCc1ccc(Oc2cccc(C)c2)cc1Cl)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H37ClNO7P/c1-19-10-8-12-21(16-19)34-22-14-13-20(23(27)17-22)11-9-15-26(5,18-33-36(30,31-6)32-7)28-24(29)35-25(2,3)4/h8,10,12-14,16-17H,9,11,15,18H2,1-7H3,(H,28,29)/t26-/m1/s1 |
| InChIKey | YUJVMKMICAZINJ-AREMUKBSSA-N |
| XLogP | 7.46 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.01 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|