C31H45ClNO8PS — CID 67288260
tert-butyl N-[(3S)-1-[2-chloro-4-[5-cyclopropyl-2-(methoxymethoxy)phenyl]sulfanylphenyl]-3-(dimethoxyphosphoryloxymethyl)hexan-3-yl]carbamate (PubChem CID 67288260) has the molecular formula C31H45ClNO8PS and a molecular weight of 658.19 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[2-chloro-4-[5-cyclopropyl-2-(methoxymethoxy)phenyl]sulfanylphenyl]-3-(dimethoxyphosphoryloxymethyl)hexan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[2-chloro-4-[5-cyclopropyl-2-(methoxymethoxy)phenyl]sulfanylphenyl]-3-(dimethoxyphosphoryloxymethyl)hexan-3-yl]carbamate |
|---|---|
| PubChem CID | 67288260 |
| Molecular Formula | C31H45ClNO8PS |
| Molecular Weight | 658.19 g/mol |
| Exact Mass | 657.23 |
| IUPAC Name | tert-butyl N-[(3S)-1-[2-chloro-4-[5-cyclopropyl-2-(methoxymethoxy)phenyl]sulfanylphenyl]-3-(dimethoxyphosphoryloxymethyl)hexan-3-yl]carbamate |
| SMILES | CCC[C@](CCc1ccc(Sc2cc(C3CC3)ccc2OCOC)cc1Cl)(COP(=O)(OC)OC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H45ClNO8PS/c1-8-16-31(20-40-42(35,37-6)38-7,33-29(34)41-30(2,3)4)17-15-23-11-13-25(19-26(23)32)43-28-18-24(22-9-10-22)12-14-27(28)39-21-36-5/h11-14,18-19,22H,8-10,15-17,20-21H2,1-7H3,(H,33,34)/t31-/m0/s1 |
| InChIKey | CWBRZGABOCCGDE-HKBQPEDESA-N |
| XLogP | 8.77 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.19 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|