C28H38ClNO6S — CID 88547626
tert-butyl N-[(3S)-1-[2-chloro-4-[5-ethoxy-2-(methoxymethoxy)phenyl]sulfanylphenyl]-3-formylhexan-3-yl]carbamate (PubChem CID 88547626) has the molecular formula C28H38ClNO6S and a molecular weight of 552.13 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[2-chloro-4-[5-ethoxy-2-(methoxymethoxy)phenyl]sulfanylphenyl]-3-formylhexan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[2-chloro-4-[5-ethoxy-2-(methoxymethoxy)phenyl]sulfanylphenyl]-3-formylhexan-3-yl]carbamate |
|---|---|
| PubChem CID | 88547626 |
| Molecular Formula | C28H38ClNO6S |
| Molecular Weight | 552.13 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | tert-butyl N-[(3S)-1-[2-chloro-4-[5-ethoxy-2-(methoxymethoxy)phenyl]sulfanylphenyl]-3-formylhexan-3-yl]carbamate |
| SMILES | CCC[C@@](C=O)(CCc1ccc(Sc2cc(OCC)ccc2OCOC)cc1Cl)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H38ClNO6S/c1-7-14-28(18-31,30-26(32)36-27(3,4)5)15-13-20-9-11-22(17-23(20)29)37-25-16-21(34-8-2)10-12-24(25)35-19-33-6/h9-12,16-18H,7-8,13-15,19H2,1-6H3,(H,30,32)/t28-/m0/s1 |
| InChIKey | MUSVCOXSVCUKKR-NDEPHWFRSA-N |
| XLogP | 7.07 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.13 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|