C33H55ClNO7PS — CID 175274341
tert-butyl [amino-[2-chloro-4-[5-ethyl-2-(methoxymethoxy)phenyl]sulfanylphenyl]-dimethoxy-λ5-phosphanyl]formate;1-(2-methylbutoxy)pentane (PubChem CID 175274341) has the molecular formula C33H55ClNO7PS and a molecular weight of 676.30 g/mol. Its IUPAC name is tert-butyl [amino-[2-chloro-4-[5-ethyl-2-(methoxymethoxy)phenyl]sulfanylphenyl]-dimethoxy-λ5-phosphanyl]formate;1-(2-methylbutoxy)pentane.
| Compound Name | tert-butyl [amino-[2-chloro-4-[5-ethyl-2-(methoxymethoxy)phenyl]sulfanylphenyl]-dimethoxy-λ5-phosphanyl]formate;1-(2-methylbutoxy)pentane |
|---|---|
| PubChem CID | 175274341 |
| Molecular Formula | C33H55ClNO7PS |
| Molecular Weight | 676.30 g/mol |
| Exact Mass | 675.31 |
| IUPAC Name | tert-butyl [amino-[2-chloro-4-[5-ethyl-2-(methoxymethoxy)phenyl]sulfanylphenyl]-dimethoxy-λ5-phosphanyl]formate;1-(2-methylbutoxy)pentane |
| SMILES | CCCCCOCC(C)CC.CCc1ccc(OCOC)c(Sc2ccc(P(N)(OC)(OC)C(=O)OC(C)(C)C)c(Cl)c2)c1 |
| InChI | InChI=1S/C23H33ClNO6PS.C10H22O/c1-8-16-9-11-19(30-15-27-5)21(13-16)33-17-10-12-20(18(24)14-17)32(25,28-6,29-7)22(26)31-23(2,3)4;1-4-6-7-8-11-9-10(3)5-2/h9-14H,8,15,25H2,1-7H3;10H,4-9H2,1-3H3 |
| InChIKey | SAOKUYWZVUUGCK-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.30 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|