C18H29N5O5Si2 — CID 137329030
2-amino-9-[(1R,7S,8R,9R)-2,5-ditert-butyl-8-hydroxy-4,6,10-trioxa-2,5-disilatricyclo[5.3.0.01,3]decan-9-yl]-1H-purin-6-one (PubChem CID 137329030) has the molecular formula C18H29N5O5Si2 and a molecular weight of 451.63 g/mol. Its IUPAC name is 2-amino-9-[(1R,7S,8R,9R)-2,5-ditert-butyl-8-hydroxy-4,6,10-trioxa-2,5-disilatricyclo[5.3.0.01,3]decan-9-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(1R,7S,8R,9R)-2,5-ditert-butyl-8-hydroxy-4,6,10-trioxa-2,5-disilatricyclo[5.3.0.01,3]decan-9-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137329030 |
| Molecular Formula | C18H29N5O5Si2 |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 2-amino-9-[(1R,7S,8R,9R)-2,5-ditert-butyl-8-hydroxy-4,6,10-trioxa-2,5-disilatricyclo[5.3.0.01,3]decan-9-yl]-1H-purin-6-one |
| SMILES | CC(C)(C)[SiH]1OC2[SiH](C(C)(C)C)[C@@]23O[C@@H](n2cnc4c(=O)[nH]c(N)nc42)[C@H](O)[C@@H]3O1 |
| InChI | InChI=1S/C18H29N5O5Si2/c1-16(2,3)29-14-18(29)10(27-30(28-14)17(4,5)6)9(24)13(26-18)23-7-20-8-11(23)21-15(19)22-12(8)25/h7,9-10,13-14,24,29-30H,1-6H3,(H3,19,21,22,25)/t9-,10+,13-,14?,18-,29?,30?/m1/s1 |
| InChIKey | NDOSLDUPYUGAEE-XRIZFVPMSA-N |
| XLogP | 0.25 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|