C12H16N6O5 — CID 140578438
2-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-[1-hydroxy-2-(methylamino)ethenyl]oxolan-2-yl]-1H-purin-6-one (PubChem CID 140578438) has the molecular formula C12H16N6O5 and a molecular weight of 324.30 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-[1-hydroxy-2-(methylamino)ethenyl]oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-[1-hydroxy-2-(methylamino)ethenyl]oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 140578438 |
| Molecular Formula | C12H16N6O5 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-[1-hydroxy-2-(methylamino)ethenyl]oxolan-2-yl]-1H-purin-6-one |
| SMILES | CNC=C(O)[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H16N6O5/c1-14-2-4(19)8-6(20)7(21)11(23-8)18-3-15-5-9(18)16-12(13)17-10(5)22/h2-3,6-8,11,14,19-21H,1H3,(H3,13,16,17,22)/t6-,7+,8+,11+/m0/s1 |
| InChIKey | KHYDFXNZQKBWPB-PRKAOEEVSA-N |
| XLogP | -2.06 |
| TPSA | 171.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|