C12H13N5O5 — CID 176543877
2-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(1-hydroxypropa-1,2-dienyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 176543877) has the molecular formula C12H13N5O5 and a molecular weight of 307.27 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(1-hydroxypropa-1,2-dienyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(1-hydroxypropa-1,2-dienyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 176543877 |
| Molecular Formula | C12H13N5O5 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(1-hydroxypropa-1,2-dienyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | C=C=C(O)[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H13N5O5/c1-2-4(18)8-6(19)7(20)11(22-8)17-3-14-5-9(17)15-12(13)16-10(5)21/h3,6-8,11,18-20H,1H2,(H3,13,15,16,21)/t6-,7+,8+,11+/m0/s1 |
| InChIKey | ZIHYPAHIECPTHW-PRKAOEEVSA-N |
| XLogP | -1.45 |
| TPSA | 159.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|