C11H14N5O7PS — CID 176846222
2-amino-9-[(2R,3R,4S,5S)-4-dihydroxyphosphinothioyloxy-3-hydroxy-5-(1-hydroxyethenyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 176846222) has the molecular formula C11H14N5O7PS and a molecular weight of 391.30 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S,5S)-4-dihydroxyphosphinothioyloxy-3-hydroxy-5-(1-hydroxyethenyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4S,5S)-4-dihydroxyphosphinothioyloxy-3-hydroxy-5-(1-hydroxyethenyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 176846222 |
| Molecular Formula | C11H14N5O7PS |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5S)-4-dihydroxyphosphinothioyloxy-3-hydroxy-5-(1-hydroxyethenyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | C=C(O)[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@H](O)[C@@H]1OP(O)(O)=S |
| InChI | InChI=1S/C11H14N5O7PS/c1-3(17)6-7(23-24(20,21)25)5(18)10(22-6)16-2-13-4-8(16)14-11(12)15-9(4)19/h2,5-7,10,17-18H,1H2,(H2,20,21,25)(H3,12,14,15,19)/t5-,6-,7+,10-/m1/s1 |
| InChIKey | HLLVFKRDSSSWIH-QGOVLLJGSA-N |
| XLogP | -1.37 |
| TPSA | 188.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|