C18H28F2OSi — CID 137329332
4-[1-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]butylsilane (PubChem CID 137329332) has the molecular formula C18H28F2OSi and a molecular weight of 326.50 g/mol. Its IUPAC name is 4-[1-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]butylsilane.
| Compound Name | 4-[1-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]butylsilane |
|---|---|
| PubChem CID | 137329332 |
| Molecular Formula | C18H28F2OSi |
| Molecular Weight | 326.50 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 4-[1-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]butylsilane |
| SMILES | CCOc1ccc(C2(CCCC[SiH3])CCCCC2)c(F)c1F |
| InChI | InChI=1S/C18H28F2OSi/c1-2-21-15-9-8-14(16(19)17(15)20)18(12-6-7-13-22)10-4-3-5-11-18/h8-9H,2-7,10-13H2,1,22H3 |
| InChIKey | MKJNOOODYYJJOK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|