C19H27ClF2OSi — CID 22878457
1-chloro-4-[1-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]silinane (PubChem CID 22878457) has the molecular formula C19H27ClF2OSi and a molecular weight of 372.96 g/mol. Its IUPAC name is 1-chloro-4-[1-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]silinane.
| Compound Name | 1-chloro-4-[1-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]silinane |
|---|---|
| PubChem CID | 22878457 |
| Molecular Formula | C19H27ClF2OSi |
| Molecular Weight | 372.96 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-chloro-4-[1-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]silinane |
| SMILES | CCOc1ccc(C2(C3CC[SiH](Cl)CC3)CCCCC2)c(F)c1F |
| InChI | InChI=1S/C19H27ClF2OSi/c1-2-23-16-7-6-15(17(21)18(16)22)19(10-4-3-5-11-19)14-8-12-24(20)13-9-14/h6-7,14,24H,2-5,8-13H2,1H3 |
| InChIKey | HQHFCDFDCHYYST-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.96 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|