C24H27NO3 — CID 137331739
(2-ethyl-5-hydroxyhexyl) (E)-3-(2-cyanophenyl)-3-phenylprop-2-enoate (PubChem CID 137331739) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is (2-ethyl-5-hydroxyhexyl) (E)-3-(2-cyanophenyl)-3-phenylprop-2-enoate.
| Compound Name | (2-ethyl-5-hydroxyhexyl) (E)-3-(2-cyanophenyl)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 137331739 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (2-ethyl-5-hydroxyhexyl) (E)-3-(2-cyanophenyl)-3-phenylprop-2-enoate |
| SMILES | CCC(CCC(C)O)COC(=O)/C=C(\c1ccccc1)c1ccccc1C#N |
| InChI | InChI=1S/C24H27NO3/c1-3-19(14-13-18(2)26)17-28-24(27)15-23(20-9-5-4-6-10-20)22-12-8-7-11-21(22)16-25/h4-12,15,18-19,26H,3,13-14,17H2,1-2H3/b23-15+ |
| InChIKey | JFILGYOBUYXGHR-HZHRSRAPSA-N |
| XLogP | 4.72 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|