C16H21FN2O3 — CID 137336157
2-fluoro-5-hydroxy-N-(1-oxa-9-azaspiro[5.5]undecan-5-yl)benzamide (PubChem CID 137336157) has the molecular formula C16H21FN2O3 and a molecular weight of 308.35 g/mol. Its IUPAC name is 2-fluoro-5-hydroxy-N-(1-oxa-9-azaspiro[5.5]undecan-5-yl)benzamide.
| Compound Name | 2-fluoro-5-hydroxy-N-(1-oxa-9-azaspiro[5.5]undecan-5-yl)benzamide |
|---|---|
| PubChem CID | 137336157 |
| Molecular Formula | C16H21FN2O3 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-fluoro-5-hydroxy-N-(1-oxa-9-azaspiro[5.5]undecan-5-yl)benzamide |
| SMILES | O=C(NC1CCCOC12CCNCC2)c1cc(O)ccc1F |
| InChI | InChI=1S/C16H21FN2O3/c17-13-4-3-11(20)10-12(13)15(21)19-14-2-1-9-22-16(14)5-7-18-8-6-16/h3-4,10,14,18,20H,1-2,5-9H2,(H,19,21) |
| InChIKey | JEOWTKWATHEUDC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |