C14H19ClN2O4S — CID 137336736
[5-(5-chloro-2-methoxyphenyl)sulfonyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 137336736) has the molecular formula C14H19ClN2O4S and a molecular weight of 346.84 g/mol. Its IUPAC name is [5-(5-chloro-2-methoxyphenyl)sulfonyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | [5-(5-chloro-2-methoxyphenyl)sulfonyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 137336736 |
| Molecular Formula | C14H19ClN2O4S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | [5-(5-chloro-2-methoxyphenyl)sulfonyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N1CC2CNCC2(CO)C1 |
| InChI | InChI=1S/C14H19ClN2O4S/c1-21-12-3-2-11(15)4-13(12)22(19,20)17-6-10-5-16-7-14(10,8-17)9-18/h2-4,10,16,18H,5-9H2,1H3 |
| InChIKey | ZKZACOINTMRCAC-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |