C18H23N3O3 — CID 137338251
(3aR,7aR)-2-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 137338251) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (3aR,7aR)-2-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aR,7aR)-2-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 137338251 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (3aR,7aR)-2-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | Cc1ccc2nc(CCN3C[C@@H]4COCC[C@]4(C(=O)O)C3)[nH]c2c1 |
| InChI | InChI=1S/C18H23N3O3/c1-12-2-3-14-15(8-12)20-16(19-14)4-6-21-9-13-10-24-7-5-18(13,11-21)17(22)23/h2-3,8,13H,4-7,9-11H2,1H3,(H,19,20)(H,22,23)/t13-,18+/m1/s1 |
| InChIKey | NBRRDTZZBADWGQ-ACJLOTCBSA-N |
| XLogP | 1.84 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |