C22H33NO4 — CID 137338526
1-[(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-2-methyl-2-(5-methyl-2-propan-2-ylphenoxy)propan-1-one (PubChem CID 137338526) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is 1-[(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-2-methyl-2-(5-methyl-2-propan-2-ylphenoxy)propan-1-one.
| Compound Name | 1-[(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-2-methyl-2-(5-methyl-2-propan-2-ylphenoxy)propan-1-one |
|---|---|
| PubChem CID | 137338526 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 1-[(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-2-methyl-2-(5-methyl-2-propan-2-ylphenoxy)propan-1-one |
| SMILES | Cc1ccc(C(C)C)c(OC(C)(C)C(=O)N2C[C@@H]3COCC[C@]3(CO)C2)c1 |
| InChI | InChI=1S/C22H33NO4/c1-15(2)18-7-6-16(3)10-19(18)27-21(4,5)20(25)23-11-17-12-26-9-8-22(17,13-23)14-24/h6-7,10,15,17,24H,8-9,11-14H2,1-5H3/t17-,22-/m1/s1 |
| InChIKey | BMJKYCNSFVCEEP-VGOFRKELSA-N |
| XLogP | 3.13 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |