C20H23NO5 — CID 137340401
[(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-[5-(3-methoxyphenyl)furan-2-yl]methanone (PubChem CID 137340401) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is [(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-[5-(3-methoxyphenyl)furan-2-yl]methanone.
| Compound Name | [(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-[5-(3-methoxyphenyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 137340401 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-[5-(3-methoxyphenyl)furan-2-yl]methanone |
| SMILES | COc1cccc(-c2ccc(C(=O)N3C[C@@H]4COCC[C@]4(CO)C3)o2)c1 |
| InChI | InChI=1S/C20H23NO5/c1-24-16-4-2-3-14(9-16)17-5-6-18(26-17)19(23)21-10-15-11-25-8-7-20(15,12-21)13-22/h2-6,9,15,22H,7-8,10-13H2,1H3/t15-,20-/m1/s1 |
| InChIKey | POOKQNKLYBLQMH-FOIQADDNSA-N |
| XLogP | 2.43 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |