C22H24FNO4 — CID 137344750
[(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-[4-[(2-fluorophenyl)methoxy]phenyl]methanone (PubChem CID 137344750) has the molecular formula C22H24FNO4 and a molecular weight of 385.44 g/mol. Its IUPAC name is [(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-[4-[(2-fluorophenyl)methoxy]phenyl]methanone.
| Compound Name | [(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-[4-[(2-fluorophenyl)methoxy]phenyl]methanone |
|---|---|
| PubChem CID | 137344750 |
| Molecular Formula | C22H24FNO4 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | [(3aR,7aR)-7a-(hydroxymethyl)-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-[4-[(2-fluorophenyl)methoxy]phenyl]methanone |
| SMILES | O=C(c1ccc(OCc2ccccc2F)cc1)N1C[C@@H]2COCC[C@]2(CO)C1 |
| InChI | InChI=1S/C22H24FNO4/c23-20-4-2-1-3-17(20)12-28-19-7-5-16(6-8-19)21(26)24-11-18-13-27-10-9-22(18,14-24)15-25/h1-8,18,25H,9-15H2/t18-,22-/m1/s1 |
| InChIKey | QYTGXCHWAPMTFA-XMSQKQJNSA-N |
| XLogP | 2.88 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |