C16H19ClFN3O2 — CID 137338814
2-[(3R,8aS)-3-methyl-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-N-(4-chloro-2-fluorophenyl)acetamide (PubChem CID 137338814) has the molecular formula C16H19ClFN3O2 and a molecular weight of 339.80 g/mol. Its IUPAC name is 2-[(3R,8aS)-3-methyl-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-N-(4-chloro-2-fluorophenyl)acetamide.
| Compound Name | 2-[(3R,8aS)-3-methyl-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-N-(4-chloro-2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 137338814 |
| Molecular Formula | C16H19ClFN3O2 |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2-[(3R,8aS)-3-methyl-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]-N-(4-chloro-2-fluorophenyl)acetamide |
| SMILES | C[C@@H]1C(=O)N2CCC[C@H]2CN1CC(=O)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C16H19ClFN3O2/c1-10-16(23)21-6-2-3-12(21)8-20(10)9-15(22)19-14-5-4-11(17)7-13(14)18/h4-5,7,10,12H,2-3,6,8-9H2,1H3,(H,19,22)/t10-,12+/m1/s1 |
| InChIKey | CDKAOQDELRDLSQ-PWSUYJOCSA-N |
| XLogP | 2.11 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |