C19H21N3O3 — CID 137338971
3-[(3R,8aR)-3-methyl-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carbonyl]-8-methyl-1H-quinolin-4-one (PubChem CID 137338971) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 3-[(3R,8aR)-3-methyl-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carbonyl]-8-methyl-1H-quinolin-4-one.
| Compound Name | 3-[(3R,8aR)-3-methyl-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carbonyl]-8-methyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 137338971 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 3-[(3R,8aR)-3-methyl-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carbonyl]-8-methyl-1H-quinolin-4-one |
| SMILES | Cc1cccc2c(=O)c(C(=O)N3C[C@H]4CCCN4C(=O)[C@H]3C)c[nH]c12 |
| InChI | InChI=1S/C19H21N3O3/c1-11-5-3-7-14-16(11)20-9-15(17(14)23)19(25)22-10-13-6-4-8-21(13)18(24)12(22)2/h3,5,7,9,12-13H,4,6,8,10H2,1-2H3,(H,20,23)/t12-,13-/m1/s1 |
| InChIKey | QZBNEOXYUOUAHN-CHWSQXEVSA-N |
| XLogP | 1.67 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |