C21H25N3O2S — CID 137342292
(3S,8aR)-2-[2-(4,6-dimethylquinolin-2-yl)sulfanylacetyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one (PubChem CID 137342292) has the molecular formula C21H25N3O2S and a molecular weight of 383.52 g/mol. Its IUPAC name is (3S,8aR)-2-[2-(4,6-dimethylquinolin-2-yl)sulfanylacetyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one.
| Compound Name | (3S,8aR)-2-[2-(4,6-dimethylquinolin-2-yl)sulfanylacetyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 137342292 |
| Molecular Formula | C21H25N3O2S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (3S,8aR)-2-[2-(4,6-dimethylquinolin-2-yl)sulfanylacetyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
| SMILES | Cc1ccc2nc(SCC(=O)N3C[C@H]4CCCN4C(=O)[C@@H]3C)cc(C)c2c1 |
| InChI | InChI=1S/C21H25N3O2S/c1-13-6-7-18-17(9-13)14(2)10-19(22-18)27-12-20(25)24-11-16-5-4-8-23(16)21(26)15(24)3/h6-7,9-10,15-16H,4-5,8,11-12H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | PNAMPYXATPYKLP-JKSUJKDBSA-N |
| XLogP | 3.17 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |