C21H19N3O3S — CID 1130711
4-[[[2-(4,6-dimethylquinolin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]benzoic acid (PubChem CID 1130711) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is 4-[[[2-(4,6-dimethylquinolin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 4-[[[2-(4,6-dimethylquinolin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 1130711 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 4-[[[2-(4,6-dimethylquinolin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]benzoic acid |
| SMILES | Cc1ccc2nc(SCC(=O)NN=Cc3ccc(C(=O)O)cc3)cc(C)c2c1 |
| InChI | InChI=1S/C21H19N3O3S/c1-13-3-8-18-17(9-13)14(2)10-20(23-18)28-12-19(25)24-22-11-15-4-6-16(7-5-15)21(26)27/h3-11H,12H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | FYEYKPKQOUQOKO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|