C20H18BrN3OS — CID 3141494
N-[(4-bromophenyl)methylideneamino]-2-(2,6-dimethylquinolin-4-yl)sulfanylacetamide (PubChem CID 3141494) has the molecular formula C20H18BrN3OS and a molecular weight of 428.36 g/mol. Its IUPAC name is N-[(4-bromophenyl)methylideneamino]-2-(2,6-dimethylquinolin-4-yl)sulfanylacetamide.
| Compound Name | N-[(4-bromophenyl)methylideneamino]-2-(2,6-dimethylquinolin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 3141494 |
| Molecular Formula | C20H18BrN3OS |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | N-[(4-bromophenyl)methylideneamino]-2-(2,6-dimethylquinolin-4-yl)sulfanylacetamide |
| SMILES | Cc1ccc2nc(C)cc(SCC(=O)NN=Cc3ccc(Br)cc3)c2c1 |
| InChI | InChI=1S/C20H18BrN3OS/c1-13-3-8-18-17(9-13)19(10-14(2)23-18)26-12-20(25)24-22-11-15-4-6-16(21)7-5-15/h3-11H,12H2,1-2H3,(H,24,25) |
| InChIKey | ZXLYTECAKADYNX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|