C21H18N3O3S- — CID 7452917
4-[(Z)-[[2-(4,6-dimethylquinolin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]benzoate (PubChem CID 7452917) has the molecular formula C21H18N3O3S- and a molecular weight of 392.46 g/mol. Its IUPAC name is 4-[(Z)-[[2-(4,6-dimethylquinolin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]benzoate.
| Compound Name | 4-[(Z)-[[2-(4,6-dimethylquinolin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 7452917 |
| Molecular Formula | C21H18N3O3S- |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 4-[(Z)-[[2-(4,6-dimethylquinolin-2-yl)sulfanylacetyl]hydrazinylidene]methyl]benzoate |
| SMILES | Cc1ccc2nc(SCC(=O)N/N=C\c3ccc(C(=O)[O-])cc3)cc(C)c2c1 |
| InChI | InChI=1S/C21H19N3O3S/c1-13-3-8-18-17(9-13)14(2)10-20(23-18)28-12-19(25)24-22-11-15-4-6-16(7-5-15)21(26)27/h3-11H,12H2,1-2H3,(H,24,25)(H,26,27)/p-1/b22-11- |
| InChIKey | FYEYKPKQOUQOKO-JJFYIABZSA-M |
| XLogP | 2.46 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|