C17H20ClN3O — CID 137344874
(3S,8aS)-2-[(3-chloro-1H-indol-2-yl)methyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one (PubChem CID 137344874) has the molecular formula C17H20ClN3O and a molecular weight of 317.82 g/mol. Its IUPAC name is (3S,8aS)-2-[(3-chloro-1H-indol-2-yl)methyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one.
| Compound Name | (3S,8aS)-2-[(3-chloro-1H-indol-2-yl)methyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 137344874 |
| Molecular Formula | C17H20ClN3O |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | (3S,8aS)-2-[(3-chloro-1H-indol-2-yl)methyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
| SMILES | C[C@H]1C(=O)N2CCC[C@H]2CN1Cc1[nH]c2ccccc2c1Cl |
| InChI | InChI=1S/C17H20ClN3O/c1-11-17(22)21-8-4-5-12(21)9-20(11)10-15-16(18)13-6-2-3-7-14(13)19-15/h2-3,6-7,11-12,19H,4-5,8-10H2,1H3/t11-,12-/m0/s1 |
| InChIKey | NXBFQBJBEFXGCE-RYUDHWBXSA-N |
| XLogP | 3.02 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |