C20H25N3O2 — CID 137336127
3-[[(3S,8aS)-3-methyl-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one (PubChem CID 137336127) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 3-[[(3S,8aS)-3-methyl-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one.
| Compound Name | 3-[[(3S,8aS)-3-methyl-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 137336127 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 3-[[(3S,8aS)-3-methyl-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one |
| SMILES | Cc1cc(C)c2[nH]c(=O)c(CN3C[C@@H]4CCCN4C(=O)[C@@H]3C)cc2c1 |
| InChI | InChI=1S/C20H25N3O2/c1-12-7-13(2)18-15(8-12)9-16(19(24)21-18)10-22-11-17-5-4-6-23(17)20(25)14(22)3/h7-9,14,17H,4-6,10-11H2,1-3H3,(H,21,24)/t14-,17-/m0/s1 |
| InChIKey | ALZOJZWWZAPXGB-YOEHRIQHSA-N |
| XLogP | 2.34 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |