C21H28N2O6 — CID 154920378
formic acid;3-[[2-(1-hydroxycyclopropyl)pyrrolidin-1-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one (PubChem CID 154920378) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is formic acid;3-[[2-(1-hydroxycyclopropyl)pyrrolidin-1-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one.
| Compound Name | formic acid;3-[[2-(1-hydroxycyclopropyl)pyrrolidin-1-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 154920378 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | formic acid;3-[[2-(1-hydroxycyclopropyl)pyrrolidin-1-yl]methyl]-6,8-dimethyl-1H-quinolin-2-one |
| SMILES | Cc1cc(C)c2[nH]c(=O)c(CN3CCCC3C3(O)CC3)cc2c1.O=CO.O=CO |
| InChI | InChI=1S/C19H24N2O2.2CH2O2/c1-12-8-13(2)17-14(9-12)10-15(18(22)20-17)11-21-7-3-4-16(21)19(23)5-6-19;2*2-1-3/h8-10,16,23H,3-7,11H2,1-2H3,(H,20,22);2*1H,(H,2,3) |
| InChIKey | AIZUEEUYNKCEIJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 130.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|