C22H31N3OS — CID 137344883
(3S,8aR)-2-[[2-(1-adamantyl)-1,3-thiazol-4-yl]methyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one (PubChem CID 137344883) has the molecular formula C22H31N3OS and a molecular weight of 385.58 g/mol. Its IUPAC name is (3S,8aR)-2-[[2-(1-adamantyl)-1,3-thiazol-4-yl]methyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one.
| Compound Name | (3S,8aR)-2-[[2-(1-adamantyl)-1,3-thiazol-4-yl]methyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 137344883 |
| Molecular Formula | C22H31N3OS |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | (3S,8aR)-2-[[2-(1-adamantyl)-1,3-thiazol-4-yl]methyl]-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
| SMILES | C[C@H]1C(=O)N2CCC[C@@H]2CN1Cc1csc(C23CC4CC(CC(C4)C2)C3)n1 |
| InChI | InChI=1S/C22H31N3OS/c1-14-20(26)25-4-2-3-19(25)12-24(14)11-18-13-27-21(23-18)22-8-15-5-16(9-22)7-17(6-15)10-22/h13-17,19H,2-12H2,1H3/t14-,15?,16?,17?,19+,22?/m0/s1 |
| InChIKey | JUOGPFXTHXDBFX-ZWCZNYOASA-N |
| XLogP | 3.81 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |