C14H21FN4O2 — CID 137345524
[(3aR,7aR)-2-[4-(dimethylamino)-5-fluoropyrimidin-2-yl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol (PubChem CID 137345524) has the molecular formula C14H21FN4O2 and a molecular weight of 296.35 g/mol. Its IUPAC name is [(3aR,7aR)-2-[4-(dimethylamino)-5-fluoropyrimidin-2-yl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol.
| Compound Name | [(3aR,7aR)-2-[4-(dimethylamino)-5-fluoropyrimidin-2-yl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol |
|---|---|
| PubChem CID | 137345524 |
| Molecular Formula | C14H21FN4O2 |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | [(3aR,7aR)-2-[4-(dimethylamino)-5-fluoropyrimidin-2-yl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-7a-yl]methanol |
| SMILES | CN(C)c1nc(N2C[C@@H]3COCC[C@]3(CO)C2)ncc1F |
| InChI | InChI=1S/C14H21FN4O2/c1-18(2)12-11(15)5-16-13(17-12)19-6-10-7-21-4-3-14(10,8-19)9-20/h5,10,20H,3-4,6-9H2,1-2H3/t10-,14-/m1/s1 |
| InChIKey | ZABAGQWVLHVMNT-QMTHXVAHSA-N |
| XLogP | 0.52 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |