C12H7FO — CID 137346061
2-fluoro-5-phenyl-7-oxabicyclo[4.1.0]hepta-1,3,5-triene (PubChem CID 137346061) has the molecular formula C12H7FO and a molecular weight of 186.19 g/mol. Its IUPAC name is 2-fluoro-5-phenyl-7-oxabicyclo[4.1.0]hepta-1,3,5-triene.
| Compound Name | 2-fluoro-5-phenyl-7-oxabicyclo[4.1.0]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 137346061 |
| Molecular Formula | C12H7FO |
| Molecular Weight | 186.19 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 2-fluoro-5-phenyl-7-oxabicyclo[4.1.0]hepta-1,3,5-triene |
| SMILES | Fc1ccc(-c2ccccc2)c2c1O2 |
| InChI | InChI=1S/C12H7FO/c13-10-7-6-9(11-12(10)14-11)8-4-2-1-3-5-8/h1-7H |
| InChIKey | AWBCDLFQVALPNQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.19 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|