C23H31N3O — CID 137346242
N-(1-adamantyl)-1-pentylpyrrolo[2,3-c]pyridine-3-carboxamide (PubChem CID 137346242) has the molecular formula C23H31N3O and a molecular weight of 365.52 g/mol. Its IUPAC name is N-(1-adamantyl)-1-pentylpyrrolo[2,3-c]pyridine-3-carboxamide.
| Compound Name | N-(1-adamantyl)-1-pentylpyrrolo[2,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 137346242 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | N-(1-adamantyl)-1-pentylpyrrolo[2,3-c]pyridine-3-carboxamide |
| SMILES | CCCCCn1cc(C(=O)NC23CC4CC(CC(C4)C2)C3)c2ccncc21 |
| InChI | InChI=1S/C23H31N3O/c1-2-3-4-7-26-15-20(19-5-6-24-14-21(19)26)22(27)25-23-11-16-8-17(12-23)10-18(9-16)13-23/h5-6,14-18H,2-4,7-13H2,1H3,(H,25,27) |
| InChIKey | SXIBFYQLRWQQNX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|