C21H27F3N2O2 — CID 71453477
N-(1-adamantyl)-6-methyl-4-oxo-1-(4,4,4-trifluorobutyl)pyridine-3-carboxamide (PubChem CID 71453477) has the molecular formula C21H27F3N2O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-(1-adamantyl)-6-methyl-4-oxo-1-(4,4,4-trifluorobutyl)pyridine-3-carboxamide.
| Compound Name | N-(1-adamantyl)-6-methyl-4-oxo-1-(4,4,4-trifluorobutyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71453477 |
| Molecular Formula | C21H27F3N2O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-(1-adamantyl)-6-methyl-4-oxo-1-(4,4,4-trifluorobutyl)pyridine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)NC23CC4CC(CC(C4)C2)C3)cn1CCCC(F)(F)F |
| InChI | InChI=1S/C21H27F3N2O2/c1-13-5-18(27)17(12-26(13)4-2-3-21(22,23)24)19(28)25-20-9-14-6-15(10-20)8-16(7-14)11-20/h5,12,14-16H,2-4,6-11H2,1H3,(H,25,28) |
| InChIKey | JETYTZFLVSGSDN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |