C32H23N3O2 — CID 137346423
2-(1H-indol-3-yl)-6-(2-oxochromen-3-yl)-4-(4-propan-2-ylphenyl)pyridine-3-carbonitrile (PubChem CID 137346423) has the molecular formula C32H23N3O2 and a molecular weight of 481.56 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-6-(2-oxochromen-3-yl)-4-(4-propan-2-ylphenyl)pyridine-3-carbonitrile.
| Compound Name | 2-(1H-indol-3-yl)-6-(2-oxochromen-3-yl)-4-(4-propan-2-ylphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 137346423 |
| Molecular Formula | C32H23N3O2 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 2-(1H-indol-3-yl)-6-(2-oxochromen-3-yl)-4-(4-propan-2-ylphenyl)pyridine-3-carbonitrile |
| SMILES | CC(C)c1ccc(-c2cc(-c3cc4ccccc4oc3=O)nc(-c3c[nH]c4ccccc34)c2C#N)cc1 |
| InChI | InChI=1S/C32H23N3O2/c1-19(2)20-11-13-21(14-12-20)24-16-29(25-15-22-7-3-6-10-30(22)37-32(25)36)35-31(26(24)17-33)27-18-34-28-9-5-4-8-23(27)28/h3-16,18-19,34H,1-2H3 |
| InChIKey | AZVMHCZULHZFIH-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|