C16H20N2O4 — CID 137350947
[3-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)piperidin-4-yl] N-methylcarbamate (PubChem CID 137350947) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is [3-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)piperidin-4-yl] N-methylcarbamate.
| Compound Name | [3-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)piperidin-4-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 137350947 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | [3-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)piperidin-4-yl] N-methylcarbamate |
| SMILES | CNC(=O)OC1CCNCC1c1ccc2c(c1C)COC2=O |
| InChI | InChI=1S/C16H20N2O4/c1-9-10(3-4-11-13(9)8-21-15(11)19)12-7-18-6-5-14(12)22-16(20)17-2/h3-4,12,14,18H,5-8H2,1-2H3,(H,17,20) |
| InChIKey | KOVSGMGGPVLSJV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |