C15H19NO3S — CID 86730513
4-methyl-5-(piperidin-4-ylmethylsulfinyl)-3H-2-benzofuran-1-one (PubChem CID 86730513) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is 4-methyl-5-(piperidin-4-ylmethylsulfinyl)-3H-2-benzofuran-1-one.
| Compound Name | 4-methyl-5-(piperidin-4-ylmethylsulfinyl)-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 86730513 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 4-methyl-5-(piperidin-4-ylmethylsulfinyl)-3H-2-benzofuran-1-one |
| SMILES | Cc1c(S(=O)CC2CCNCC2)ccc2c1COC2=O |
| InChI | InChI=1S/C15H19NO3S/c1-10-13-8-19-15(17)12(13)2-3-14(10)20(18)9-11-4-6-16-7-5-11/h2-3,11,16H,4-9H2,1H3 |
| InChIKey | XLMFNEAEABHBCQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |