C16H21NO3 — CID 123745622
5-(5-ethyl-1,4-oxazepan-2-yl)-4-methyl-3H-2-benzofuran-1-one (PubChem CID 123745622) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 5-(5-ethyl-1,4-oxazepan-2-yl)-4-methyl-3H-2-benzofuran-1-one.
| Compound Name | 5-(5-ethyl-1,4-oxazepan-2-yl)-4-methyl-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 123745622 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 5-(5-ethyl-1,4-oxazepan-2-yl)-4-methyl-3H-2-benzofuran-1-one |
| SMILES | CCC1CCOC(c2ccc3c(c2C)COC3=O)CN1 |
| InChI | InChI=1S/C16H21NO3/c1-3-11-6-7-19-15(8-17-11)12-4-5-13-14(10(12)2)9-20-16(13)18/h4-5,11,15,17H,3,6-9H2,1-2H3 |
| InChIKey | BFWZHJMQQDWDEI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |