C23H21F3N4O3 — CID 137351499
[6-(phenylmethoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-[4-[4-(trifluoromethoxy)phenyl]triazol-1-yl]methanone (PubChem CID 137351499) has the molecular formula C23H21F3N4O3 and a molecular weight of 458.44 g/mol. Its IUPAC name is [6-(phenylmethoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-[4-[4-(trifluoromethoxy)phenyl]triazol-1-yl]methanone.
| Compound Name | [6-(phenylmethoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-[4-[4-(trifluoromethoxy)phenyl]triazol-1-yl]methanone |
|---|---|
| PubChem CID | 137351499 |
| Molecular Formula | C23H21F3N4O3 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | [6-(phenylmethoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-[4-[4-(trifluoromethoxy)phenyl]triazol-1-yl]methanone |
| SMILES | O=C(N1CCC=CC1COCc1ccccc1)n1cc(-c2ccc(OC(F)(F)F)cc2)nn1 |
| InChI | InChI=1S/C23H21F3N4O3/c24-23(25,26)33-20-11-9-18(10-12-20)21-14-30(28-27-21)22(31)29-13-5-4-8-19(29)16-32-15-17-6-2-1-3-7-17/h1-4,6-12,14,19H,5,13,15-16H2 |
| InChIKey | SEFWUNUYZILHQY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|