C26H24F3N3O4 — CID 129201926
[(3R,6R)-3-hydroxy-6-(phenylmethoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-[6-[4-(trifluoromethoxy)phenyl]-1,2-diazacyclohepta-2,3,6-trien-1-yl]methanone (PubChem CID 129201926) has the molecular formula C26H24F3N3O4 and a molecular weight of 499.49 g/mol. Its IUPAC name is [(3R,6R)-3-hydroxy-6-(phenylmethoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-[6-[4-(trifluoromethoxy)phenyl]-1,2-diazacyclohepta-2,3,6-trien-1-yl]methanone.
| Compound Name | [(3R,6R)-3-hydroxy-6-(phenylmethoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-[6-[4-(trifluoromethoxy)phenyl]-1,2-diazacyclohepta-2,3,6-trien-1-yl]methanone |
|---|---|
| PubChem CID | 129201926 |
| Molecular Formula | C26H24F3N3O4 |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | [(3R,6R)-3-hydroxy-6-(phenylmethoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]-[6-[4-(trifluoromethoxy)phenyl]-1,2-diazacyclohepta-2,3,6-trien-1-yl]methanone |
| SMILES | O=C(N1C=C(c2ccc(OC(F)(F)F)cc2)CC=C=N1)N1C[C@H](O)C=C[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C26H24F3N3O4/c27-26(28,29)36-24-12-8-20(9-13-24)21-7-4-14-30-32(15-21)25(34)31-16-23(33)11-10-22(31)18-35-17-19-5-2-1-3-6-19/h1-6,8-13,15,22-23,33H,7,16-18H2/t22-,23-/m1/s1 |
| InChIKey | SVTSVETXSJNZFO-DHIUTWEWSA-N |
| XLogP | 4.71 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|