C15H16F3N3O — CID 137353407
5-(aminomethyl)-1-propan-2-yl-3-[5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one (PubChem CID 137353407) has the molecular formula C15H16F3N3O and a molecular weight of 311.31 g/mol. Its IUPAC name is 5-(aminomethyl)-1-propan-2-yl-3-[5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one.
| Compound Name | 5-(aminomethyl)-1-propan-2-yl-3-[5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one |
|---|---|
| PubChem CID | 137353407 |
| Molecular Formula | C15H16F3N3O |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 5-(aminomethyl)-1-propan-2-yl-3-[5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one |
| SMILES | CC(C)n1cc(CN)cc(-c2ccc(C(F)(F)F)cn2)c1=O |
| InChI | InChI=1S/C15H16F3N3O/c1-9(2)21-8-10(6-19)5-12(14(21)22)13-4-3-11(7-20-13)15(16,17)18/h3-5,7-9H,6,19H2,1-2H3 |
| InChIKey | KIPYXUWUZVKCRE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |