C14H14F6N2O — CID 137362430
3-(4-aminophenyl)-N-cyclopropyl-4,4,4-trifluoro-3-(trifluoromethyl)butanamide (PubChem CID 137362430) has the molecular formula C14H14F6N2O and a molecular weight of 340.27 g/mol. Its IUPAC name is 3-(4-aminophenyl)-N-cyclopropyl-4,4,4-trifluoro-3-(trifluoromethyl)butanamide.
| Compound Name | 3-(4-aminophenyl)-N-cyclopropyl-4,4,4-trifluoro-3-(trifluoromethyl)butanamide |
|---|---|
| PubChem CID | 137362430 |
| Molecular Formula | C14H14F6N2O |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 3-(4-aminophenyl)-N-cyclopropyl-4,4,4-trifluoro-3-(trifluoromethyl)butanamide |
| SMILES | Nc1ccc(C(CC(=O)NC2CC2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H14F6N2O/c15-13(16,17)12(14(18,19)20,7-11(23)22-10-5-6-10)8-1-3-9(21)4-2-8/h1-4,10H,5-7,21H2,(H,22,23) |
| InChIKey | RNZQJERURITNQR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|