C26H26F6N3O5S+ — CID 162610434
CID 162610434 (PubChem CID 162610434) has the molecular formula C26H26F6N3O5S+ and a molecular weight of 606.57 g/mol.
| Compound Name | CID 162610434 |
|---|---|
| PubChem CID | 162610434 |
| Molecular Formula | C26H26F6N3O5S+ |
| Molecular Weight | 606.57 g/mol |
| Exact Mass | 606.15 |
| IUPAC Name | — |
| SMILES | CC(=O)N1Cc2cc([S+](C)(=O)O)ccc2C1C(=O)Nc1ccc(C(CC(=O)NC2CC2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H25F6N3O5S/c1-14(36)35-13-15-11-19(41(2,39)40)9-10-20(15)22(35)23(38)34-18-5-3-16(4-6-18)24(25(27,28)29,26(30,31)32)12-21(37)33-17-7-8-17/h3-6,9-11,17,22H,7-8,12-13H2,1-2H3,(H2-,33,34,37,38,39,40)/p+1 |
| InChIKey | RKCZLOIZTHGAEK-UHFFFAOYSA-O |
| XLogP | 4.72 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|