C27H22F6N2O5S — CID 166846821
2-acetyl-N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]-5-methylsulfonyl-1,3-dihydroisoindole-1-carboxamide (PubChem CID 166846821) has the molecular formula C27H22F6N2O5S and a molecular weight of 600.54 g/mol. Its IUPAC name is 2-acetyl-N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]-5-methylsulfonyl-1,3-dihydroisoindole-1-carboxamide.
| Compound Name | 2-acetyl-N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]-5-methylsulfonyl-1,3-dihydroisoindole-1-carboxamide |
|---|---|
| PubChem CID | 166846821 |
| Molecular Formula | C27H22F6N2O5S |
| Molecular Weight | 600.54 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | 2-acetyl-N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]-5-methylsulfonyl-1,3-dihydroisoindole-1-carboxamide |
| SMILES | CC(=O)N1Cc2cc(S(C)(=O)=O)ccc2C1C(=O)Nc1ccc(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H22F6N2O5S/c1-15(36)35-14-18-13-21(41(2,39)40)11-12-22(18)23(35)24(37)34-20-9-5-17(6-10-20)16-3-7-19(8-4-16)25(38,26(28,29)30)27(31,32)33/h3-13,23,38H,14H2,1-2H3,(H,34,37) |
| InChIKey | FFQKZFJPBSGWLH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |