C24H26F6N2O4S — CID 152722818
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(3-methylbutyl)-5-methylsulfonyl-1,3-dihydroisoindole-1-carboxamide (PubChem CID 152722818) has the molecular formula C24H26F6N2O4S and a molecular weight of 552.54 g/mol. Its IUPAC name is N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(3-methylbutyl)-5-methylsulfonyl-1,3-dihydroisoindole-1-carboxamide.
| Compound Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(3-methylbutyl)-5-methylsulfonyl-1,3-dihydroisoindole-1-carboxamide |
|---|---|
| PubChem CID | 152722818 |
| Molecular Formula | C24H26F6N2O4S |
| Molecular Weight | 552.54 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(3-methylbutyl)-5-methylsulfonyl-1,3-dihydroisoindole-1-carboxamide |
| SMILES | CC(C)CCN1Cc2cc(S(C)(=O)=O)ccc2C1C(=O)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H26F6N2O4S/c1-14(2)10-11-32-13-15-12-18(37(3,35)36)8-9-19(15)20(32)21(33)31-17-6-4-16(5-7-17)22(34,23(25,26)27)24(28,29)30/h4-9,12,14,20,34H,10-11,13H2,1-3H3,(H,31,33) |
| InChIKey | ZVZAWXSQRXYHDP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |