C23H19F7N2O6S — CID 129205408
5-[(1-fluorocyclopropyl)methylsulfonyl]-1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-1,3-dihydroisoindole-2-carboxylic acid (PubChem CID 129205408) has the molecular formula C23H19F7N2O6S and a molecular weight of 584.47 g/mol. Its IUPAC name is 5-[(1-fluorocyclopropyl)methylsulfonyl]-1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-1,3-dihydroisoindole-2-carboxylic acid.
| Compound Name | 5-[(1-fluorocyclopropyl)methylsulfonyl]-1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-1,3-dihydroisoindole-2-carboxylic acid |
|---|---|
| PubChem CID | 129205408 |
| Molecular Formula | C23H19F7N2O6S |
| Molecular Weight | 584.47 g/mol |
| Exact Mass | 584.09 |
| IUPAC Name | 5-[(1-fluorocyclopropyl)methylsulfonyl]-1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-1,3-dihydroisoindole-2-carboxylic acid |
| SMILES | O=C(Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)C1c2ccc(S(=O)(=O)CC3(F)CC3)cc2CN1C(=O)O |
| InChI | InChI=1S/C23H19F7N2O6S/c24-20(7-8-20)11-39(37,38)15-5-6-16-12(9-15)10-32(19(34)35)17(16)18(33)31-14-3-1-13(2-4-14)21(36,22(25,26)27)23(28,29)30/h1-6,9,17,36H,7-8,10-11H2,(H,31,33)(H,34,35) |
| InChIKey | FQDGCOABNQZESO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |