C23H19F6N3O4S — CID 129205260
5-[(1-cyanocyclopropyl)methylsulfonyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,3-dihydro-1H-isoindole-1-carboxamide (PubChem CID 129205260) has the molecular formula C23H19F6N3O4S and a molecular weight of 547.48 g/mol. Its IUPAC name is 5-[(1-cyanocyclopropyl)methylsulfonyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,3-dihydro-1H-isoindole-1-carboxamide.
| Compound Name | 5-[(1-cyanocyclopropyl)methylsulfonyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,3-dihydro-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 129205260 |
| Molecular Formula | C23H19F6N3O4S |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | 5-[(1-cyanocyclopropyl)methylsulfonyl]-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2,3-dihydro-1H-isoindole-1-carboxamide |
| SMILES | N#CC1(CS(=O)(=O)c2ccc3c(c2)CNC3C(=O)Nc2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C23H19F6N3O4S/c24-22(25,26)21(34,23(27,28)29)14-1-3-15(4-2-14)32-19(33)18-17-6-5-16(9-13(17)10-31-18)37(35,36)12-20(11-30)7-8-20/h1-6,9,18,31,34H,7-8,10,12H2,(H,32,33) |
| InChIKey | NVRGCPHBVBDUFU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |