C27H26F6N2O6S — CID 129205444
5-(cyclopropylmethylsulfonyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(oxolane-3-carbonyl)-1,3-dihydroisoindole-1-carboxamide (PubChem CID 129205444) has the molecular formula C27H26F6N2O6S and a molecular weight of 620.57 g/mol. Its IUPAC name is 5-(cyclopropylmethylsulfonyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(oxolane-3-carbonyl)-1,3-dihydroisoindole-1-carboxamide.
| Compound Name | 5-(cyclopropylmethylsulfonyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(oxolane-3-carbonyl)-1,3-dihydroisoindole-1-carboxamide |
|---|---|
| PubChem CID | 129205444 |
| Molecular Formula | C27H26F6N2O6S |
| Molecular Weight | 620.57 g/mol |
| Exact Mass | 620.14 |
| IUPAC Name | 5-(cyclopropylmethylsulfonyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(oxolane-3-carbonyl)-1,3-dihydroisoindole-1-carboxamide |
| SMILES | O=C(Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)C1c2ccc(S(=O)(=O)CC3CC3)cc2CN1C(=O)C1CCOC1 |
| InChI | InChI=1S/C27H26F6N2O6S/c28-26(29,30)25(38,27(31,32)33)18-3-5-19(6-4-18)34-23(36)22-21-8-7-20(42(39,40)14-15-1-2-15)11-17(21)12-35(22)24(37)16-9-10-41-13-16/h3-8,11,15-16,22,38H,1-2,9-10,12-14H2,(H,34,36) |
| InChIKey | UJNUAIFOUAXMJO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |