C27H22F6N2O6S — CID 135188626
benzyl 1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-5-methylsulfonyl-1,3-dihydroisoindole-2-carboxylate (PubChem CID 135188626) has the molecular formula C27H22F6N2O6S and a molecular weight of 616.54 g/mol. Its IUPAC name is benzyl 1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-5-methylsulfonyl-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | benzyl 1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-5-methylsulfonyl-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 135188626 |
| Molecular Formula | C27H22F6N2O6S |
| Molecular Weight | 616.54 g/mol |
| Exact Mass | 616.11 |
| IUPAC Name | benzyl 1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]carbamoyl]-5-methylsulfonyl-1,3-dihydroisoindole-2-carboxylate |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CN(C(=O)OCc1ccccc1)C2C(=O)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H22F6N2O6S/c1-42(39,40)20-11-12-21-17(13-20)14-35(24(37)41-15-16-5-3-2-4-6-16)22(21)23(36)34-19-9-7-18(8-10-19)25(38,26(28,29)30)27(31,32)33/h2-13,22,38H,14-15H2,1H3,(H,34,36) |
| InChIKey | KCGXWMIQHDUYEL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |