C21H19F6N3O6S — CID 129205401
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(2-hydroxyacetyl)-5-(methylsulfamoyl)-1,3-dihydroisoindole-1-carboxamide (PubChem CID 129205401) has the molecular formula C21H19F6N3O6S and a molecular weight of 555.45 g/mol. Its IUPAC name is N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(2-hydroxyacetyl)-5-(methylsulfamoyl)-1,3-dihydroisoindole-1-carboxamide.
| Compound Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(2-hydroxyacetyl)-5-(methylsulfamoyl)-1,3-dihydroisoindole-1-carboxamide |
|---|---|
| PubChem CID | 129205401 |
| Molecular Formula | C21H19F6N3O6S |
| Molecular Weight | 555.45 g/mol |
| Exact Mass | 555.09 |
| IUPAC Name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-(2-hydroxyacetyl)-5-(methylsulfamoyl)-1,3-dihydroisoindole-1-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc2c(c1)CN(C(=O)CO)C2C(=O)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19F6N3O6S/c1-28-37(35,36)14-6-7-15-11(8-14)9-30(16(32)10-31)17(15)18(33)29-13-4-2-12(3-5-13)19(34,20(22,23)24)21(25,26)27/h2-8,17,28,31,34H,9-10H2,1H3,(H,29,33) |
| InChIKey | GWOOKSDDUBLWIZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |